C14H26O4S2 — CID 11638375
2-[2-[2-(2,2-dimethoxyethyl)-1,3-dithian-2-yl]ethyl]-2-methyl-1,3-dioxolane (PubChem CID 11638375) has the molecular formula C14H26O4S2 and a molecular weight of 322.49 g/mol. Its IUPAC name is 2-[2-[2-(2,2-dimethoxyethyl)-1,3-dithian-2-yl]ethyl]-2-methyl-1,3-dioxolane.
| Compound Name | 2-[2-[2-(2,2-dimethoxyethyl)-1,3-dithian-2-yl]ethyl]-2-methyl-1,3-dioxolane |
|---|---|
| PubChem CID | 11638375 |
| Molecular Formula | C14H26O4S2 |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | 2-[2-[2-(2,2-dimethoxyethyl)-1,3-dithian-2-yl]ethyl]-2-methyl-1,3-dioxolane |
| SMILES | COC(CC1(CCC2(C)OCCO2)SCCCS1)OC |
| InChI | InChI=1S/C14H26O4S2/c1-13(17-7-8-18-13)5-6-14(11-12(15-2)16-3)19-9-4-10-20-14/h12H,4-11H2,1-3H3 |
| InChIKey | VFXRIZWGWDCKIC-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|