C12H22O2S2 — CID 11832236
2-[5-(1,3-dithian-2-yl)pentyl]-1,3-dioxolane (PubChem CID 11832236) has the molecular formula C12H22O2S2 and a molecular weight of 262.44 g/mol. Its IUPAC name is 2-[5-(1,3-dithian-2-yl)pentyl]-1,3-dioxolane.
| Compound Name | 2-[5-(1,3-dithian-2-yl)pentyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 11832236 |
| Molecular Formula | C12H22O2S2 |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 2-[5-(1,3-dithian-2-yl)pentyl]-1,3-dioxolane |
| SMILES | C(CCC1OCCO1)CCC1SCCCS1 |
| InChI | InChI=1S/C12H22O2S2/c1(2-5-11-13-7-8-14-11)3-6-12-15-9-4-10-16-12/h11-12H,1-10H2 |
| InChIKey | YUMYUPAFZMOEOM-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|