C16H28O4S2 — CID 23254613
2-[2-[2-[4-(1,3-dioxolan-2-yl)butyl]-1,3-dithian-2-yl]ethyl]-1,3-dioxolane (PubChem CID 23254613) has the molecular formula C16H28O4S2 and a molecular weight of 348.53 g/mol. Its IUPAC name is 2-[2-[2-[4-(1,3-dioxolan-2-yl)butyl]-1,3-dithian-2-yl]ethyl]-1,3-dioxolane.
| Compound Name | 2-[2-[2-[4-(1,3-dioxolan-2-yl)butyl]-1,3-dithian-2-yl]ethyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 23254613 |
| Molecular Formula | C16H28O4S2 |
| Molecular Weight | 348.53 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 2-[2-[2-[4-(1,3-dioxolan-2-yl)butyl]-1,3-dithian-2-yl]ethyl]-1,3-dioxolane |
| SMILES | C1CSC(CCCCC2OCCO2)(CCC2OCCO2)SC1 |
| InChI | InChI=1S/C16H28O4S2/c1(4-14-17-8-9-18-14)2-6-16(21-12-3-13-22-16)7-5-15-19-10-11-20-15/h14-15H,1-13H2 |
| InChIKey | LUELSLHIDIFUAX-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.53 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|