C18H36O2S2 — CID 10521721
2-butyl-2-[8-(methoxymethoxy)octyl]-1,3-dithiane (PubChem CID 10521721) has the molecular formula C18H36O2S2 and a molecular weight of 348.62 g/mol. Its IUPAC name is 2-butyl-2-[8-(methoxymethoxy)octyl]-1,3-dithiane.
| Compound Name | 2-butyl-2-[8-(methoxymethoxy)octyl]-1,3-dithiane |
|---|---|
| PubChem CID | 10521721 |
| Molecular Formula | C18H36O2S2 |
| Molecular Weight | 348.62 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | 2-butyl-2-[8-(methoxymethoxy)octyl]-1,3-dithiane |
| SMILES | CCCCC1(CCCCCCCCOCOC)SCCCS1 |
| InChI | InChI=1S/C18H36O2S2/c1-3-4-12-18(21-15-11-16-22-18)13-9-7-5-6-8-10-14-20-17-19-2/h3-17H2,1-2H3 |
| InChIKey | NRJRETKKXUTONV-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.62 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|