C16H32O4S2 — CID 14198002
2-(2,2-dimethoxyethyl)-2-(2,2-dimethoxyhexyl)-1,3-dithiane (PubChem CID 14198002) has the molecular formula C16H32O4S2 and a molecular weight of 352.56 g/mol. Its IUPAC name is 2-(2,2-dimethoxyethyl)-2-(2,2-dimethoxyhexyl)-1,3-dithiane.
| Compound Name | 2-(2,2-dimethoxyethyl)-2-(2,2-dimethoxyhexyl)-1,3-dithiane |
|---|---|
| PubChem CID | 14198002 |
| Molecular Formula | C16H32O4S2 |
| Molecular Weight | 352.56 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | 2-(2,2-dimethoxyethyl)-2-(2,2-dimethoxyhexyl)-1,3-dithiane |
| SMILES | CCCCC(CC1(CC(OC)OC)SCCCS1)(OC)OC |
| InChI | InChI=1S/C16H32O4S2/c1-6-7-9-15(19-4,20-5)13-16(12-14(17-2)18-3)21-10-8-11-22-16/h14H,6-13H2,1-5H3 |
| InChIKey | UHIMCQBNEGPAGZ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.56 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|