C16H32O2S2 — CID 10892575
2-butyl-2-[6-(methoxymethoxy)hexyl]-1,3-dithiane (PubChem CID 10892575) has the molecular formula C16H32O2S2 and a molecular weight of 320.56 g/mol. Its IUPAC name is 2-butyl-2-[6-(methoxymethoxy)hexyl]-1,3-dithiane.
| Compound Name | 2-butyl-2-[6-(methoxymethoxy)hexyl]-1,3-dithiane |
|---|---|
| PubChem CID | 10892575 |
| Molecular Formula | C16H32O2S2 |
| Molecular Weight | 320.56 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | 2-butyl-2-[6-(methoxymethoxy)hexyl]-1,3-dithiane |
| SMILES | CCCCC1(CCCCCCOCOC)SCCCS1 |
| InChI | InChI=1S/C16H32O2S2/c1-3-4-10-16(19-13-9-14-20-16)11-7-5-6-8-12-18-15-17-2/h3-15H2,1-2H3 |
| InChIKey | ANJYNAPXFGRRSW-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.56 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|