C17H34O2S2 — CID 14862655
2-[(2R,8R)-2,8-dimethoxyundecyl]-1,3-dithiane (PubChem CID 14862655) has the molecular formula C17H34O2S2 and a molecular weight of 334.59 g/mol. Its IUPAC name is 2-[(2R,8R)-2,8-dimethoxyundecyl]-1,3-dithiane.
| Compound Name | 2-[(2R,8R)-2,8-dimethoxyundecyl]-1,3-dithiane |
|---|---|
| PubChem CID | 14862655 |
| Molecular Formula | C17H34O2S2 |
| Molecular Weight | 334.59 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | 2-[(2R,8R)-2,8-dimethoxyundecyl]-1,3-dithiane |
| SMILES | CCC[C@H](CCCCC[C@H](CC1SCCCS1)OC)OC |
| InChI | InChI=1S/C17H34O2S2/c1-4-9-15(18-2)10-6-5-7-11-16(19-3)14-17-20-12-8-13-21-17/h15-17H,4-14H2,1-3H3/t15-,16-/m1/s1 |
| InChIKey | CGADYUZIJALPSV-HZPDHXFCSA-N |
| XLogP | 5.35 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.59 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|