C27H56O3S — CID 151590425
1,1,1-triethoxy-8-octylsulfanyltridecane (PubChem CID 151590425) has the molecular formula C27H56O3S and a molecular weight of 460.81 g/mol. Its IUPAC name is 1,1,1-triethoxy-8-octylsulfanyltridecane.
| Compound Name | 1,1,1-triethoxy-8-octylsulfanyltridecane |
|---|---|
| PubChem CID | 151590425 |
| Molecular Formula | C27H56O3S |
| Molecular Weight | 460.81 g/mol |
| Exact Mass | 460.40 |
| IUPAC Name | 1,1,1-triethoxy-8-octylsulfanyltridecane |
| SMILES | CCCCCCCCSC(CCCCC)CCCCCCC(OCC)(OCC)OCC |
| InChI | InChI=1S/C27H56O3S/c1-6-11-13-14-17-21-25-31-26(22-18-12-7-2)23-19-15-16-20-24-27(28-8-3,29-9-4)30-10-5/h26H,6-25H2,1-5H3 |
| InChIKey | QIJWFHLZPZTEST-UHFFFAOYSA-N |
| XLogP | 9.13 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.81 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|