About 2-[4-(1-ethoxyethoxy)butyl]-1,3-dithiane
2-[4-(1-ethoxyethoxy)butyl]-1,3-dithiane (PubChem CID 576633) has the molecular formula C12H24O2S2
and a molecular weight of 264.46 g/mol. Its IUPAC name is 2-[4-(1-ethoxyethoxy)butyl]-1,3-dithiane.
Molecular Properties
| Compound Name | 2-[4-(1-ethoxyethoxy)butyl]-1,3-dithiane |
| PubChem CID | 576633 |
| Molecular Formula | C12H24O2S2 |
| Molecular Weight | 264.46 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 2-[4-(1-ethoxyethoxy)butyl]-1,3-dithiane |
| SMILES | CCOC(C)OCCCCC1SCCCS1 |
| InChI | InChI=1S/C12H24O2S2/c1-3-13-11(2)14-8-5-4-7-12-15-9-6-10-16-12/h11-12H,3-10H2,1-2H3 |
| InChIKey | BOHKBUQLBWTJBM-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.46 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(1-ethoxyethoxy)butyl]-1,3-dithiane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(1-ethoxyethoxy)butyl]-1,3-dithiane?
The IUPAC name of 2-[4-(1-ethoxyethoxy)butyl]-1,3-dithiane (CID 576633) is 2-[4-(1-ethoxyethoxy)butyl]-1,3-dithiane.
What is the SMILES notation for 2-[4-(1-ethoxyethoxy)butyl]-1,3-dithiane?
The canonical SMILES for 2-[4-(1-ethoxyethoxy)butyl]-1,3-dithiane is CCOC(C)OCCCCC1SCCCS1.
What is the InChIKey of 2-[4-(1-ethoxyethoxy)butyl]-1,3-dithiane?
The InChIKey is BOHKBUQLBWTJBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24O2S2/c1-3-13-11(2)14-8-5-4-7-12-15-9-6-10-16-12/h11-12H,3-10H2,1-2H3.
What are the key properties of 2-[4-(1-ethoxyethoxy)butyl]-1,3-dithiane?
2-[4-(1-ethoxyethoxy)butyl]-1,3-dithiane has a molecular weight of 264.46 g/mol, XLogP of 3.75, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(1-ethoxyethoxy)butyl]-1,3-dithiane is sourced from PubChem (CID 576633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).