C19H25F6N4P — CID 11213187
1-[4-(azidomethyl)phenyl]-N-[(4-tert-butylphenyl)methyl]methanamine;pentafluoro-λ5-phosphane;hydrofluoride (PubChem CID 11213187) has the molecular formula C19H25F6N4P and a molecular weight of 454.40 g/mol. Its IUPAC name is 1-[4-(azidomethyl)phenyl]-N-[(4-tert-butylphenyl)methyl]methanamine;pentafluoro-λ5-phosphane;hydrofluoride.
| Compound Name | 1-[4-(azidomethyl)phenyl]-N-[(4-tert-butylphenyl)methyl]methanamine;pentafluoro-λ5-phosphane;hydrofluoride |
|---|---|
| PubChem CID | 11213187 |
| Molecular Formula | C19H25F6N4P |
| Molecular Weight | 454.40 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | 1-[4-(azidomethyl)phenyl]-N-[(4-tert-butylphenyl)methyl]methanamine;pentafluoro-λ5-phosphane;hydrofluoride |
| SMILES | CC(C)(C)c1ccc(CNCc2ccc(CN=[N+]=[N-])cc2)cc1.F.FP(F)(F)(F)F |
| InChI | InChI=1S/C19H24N4.F5P.FH/c1-19(2,3)18-10-8-16(9-11-18)13-21-12-15-4-6-17(7-5-15)14-22-23-20;1-6(2,3,4)5;/h4-11,21H,12-14H2,1-3H3;;1H |
| InChIKey | ARMTYDAYXRPRDK-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 60.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.40 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|