C24H30Cl2N2O3 — CID 11213445
3-[2-(2,4-dichlorophenyl)ethoxy]-4-methoxy-N-(3-piperidin-1-ylpropyl)benzamide (PubChem CID 11213445) has the molecular formula C24H30Cl2N2O3 and a molecular weight of 465.42 g/mol. Its IUPAC name is 3-[2-(2,4-dichlorophenyl)ethoxy]-4-methoxy-N-(3-piperidin-1-ylpropyl)benzamide.
| Compound Name | 3-[2-(2,4-dichlorophenyl)ethoxy]-4-methoxy-N-(3-piperidin-1-ylpropyl)benzamide |
|---|---|
| PubChem CID | 11213445 |
| Molecular Formula | C24H30Cl2N2O3 |
| Molecular Weight | 465.42 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | 3-[2-(2,4-dichlorophenyl)ethoxy]-4-methoxy-N-(3-piperidin-1-ylpropyl)benzamide |
| SMILES | COc1ccc(C(=O)NCCCN2CCCCC2)cc1OCCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C24H30Cl2N2O3/c1-30-22-9-7-19(24(29)27-11-5-14-28-12-3-2-4-13-28)16-23(22)31-15-10-18-6-8-20(25)17-21(18)26/h6-9,16-17H,2-5,10-15H2,1H3,(H,27,29) |
| InChIKey | FDWXFMBRFUBYTF-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.42 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|