C24H30Cl2N6O4 — CID 23396244
N-[1-[2-[2-(diaminomethylidene)hydrazinyl]-2-oxoethyl]piperidin-4-yl]-3-[2-(2,4-dichlorophenyl)ethoxy]-4-methoxybenzamide (PubChem CID 23396244) has the molecular formula C24H30Cl2N6O4 and a molecular weight of 537.45 g/mol. Its IUPAC name is N-[1-[2-[2-(diaminomethylidene)hydrazinyl]-2-oxoethyl]piperidin-4-yl]-3-[2-(2,4-dichlorophenyl)ethoxy]-4-methoxybenzamide.
| Compound Name | N-[1-[2-[2-(diaminomethylidene)hydrazinyl]-2-oxoethyl]piperidin-4-yl]-3-[2-(2,4-dichlorophenyl)ethoxy]-4-methoxybenzamide |
|---|---|
| PubChem CID | 23396244 |
| Molecular Formula | C24H30Cl2N6O4 |
| Molecular Weight | 537.45 g/mol |
| Exact Mass | 536.17 |
| IUPAC Name | N-[1-[2-[2-(diaminomethylidene)hydrazinyl]-2-oxoethyl]piperidin-4-yl]-3-[2-(2,4-dichlorophenyl)ethoxy]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)NC2CCN(CC(=O)NN=C(N)N)CC2)cc1OCCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C24H30Cl2N6O4/c1-35-20-5-3-16(12-21(20)36-11-8-15-2-4-17(25)13-19(15)26)23(34)29-18-6-9-32(10-7-18)14-22(33)30-31-24(27)28/h2-5,12-13,18H,6-11,14H2,1H3,(H,29,34)(H,30,33)(H4,27,28,31) |
| InChIKey | QKJJVIMSOIHBBC-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 144.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.45 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|