C23H25FN4O4S — CID 11213614
1-[3-fluoro-4-[4-[2-(3-nitrothiomorpholin-4-yl)benzoyl]piperazin-1-yl]phenyl]ethanone (PubChem CID 11213614) has the molecular formula C23H25FN4O4S and a molecular weight of 472.54 g/mol. Its IUPAC name is 1-[3-fluoro-4-[4-[2-(3-nitrothiomorpholin-4-yl)benzoyl]piperazin-1-yl]phenyl]ethanone.
| Compound Name | 1-[3-fluoro-4-[4-[2-(3-nitrothiomorpholin-4-yl)benzoyl]piperazin-1-yl]phenyl]ethanone |
|---|---|
| PubChem CID | 11213614 |
| Molecular Formula | C23H25FN4O4S |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | 1-[3-fluoro-4-[4-[2-(3-nitrothiomorpholin-4-yl)benzoyl]piperazin-1-yl]phenyl]ethanone |
| SMILES | CC(=O)c1ccc(N2CCN(C(=O)c3ccccc3N3CCSCC3[N+](=O)[O-])CC2)c(F)c1 |
| InChI | InChI=1S/C23H25FN4O4S/c1-16(29)17-6-7-21(19(24)14-17)25-8-10-26(11-9-25)23(30)18-4-2-3-5-20(18)27-12-13-33-15-22(27)28(31)32/h2-7,14,22H,8-13,15H2,1H3 |
| InChIKey | ASOKXHOMEILHBN-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 87.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|