C23H24N6O7 — CID 11214122
(7S,10S)-10-(hydroxymethyl)-24-nitro-2,8,11-trioxo-3,9,12,20-tetrazatetracyclo[19.4.0.03,7.013,18]pentacosa-1(21),13(18),14,16,22,24-hexaene-15-carboxamide (PubChem CID 11214122) has the molecular formula C23H24N6O7 and a molecular weight of 496.48 g/mol. Its IUPAC name is (7S,10S)-10-(hydroxymethyl)-24-nitro-2,8,11-trioxo-3,9,12,20-tetrazatetracyclo[19.4.0.03,7.013,18]pentacosa-1(21),13(18),14,16,22,24-hexaene-15-carboxamide.
| Compound Name | (7S,10S)-10-(hydroxymethyl)-24-nitro-2,8,11-trioxo-3,9,12,20-tetrazatetracyclo[19.4.0.03,7.013,18]pentacosa-1(21),13(18),14,16,22,24-hexaene-15-carboxamide |
|---|---|
| PubChem CID | 11214122 |
| Molecular Formula | C23H24N6O7 |
| Molecular Weight | 496.48 g/mol |
| Exact Mass | 496.17 |
| IUPAC Name | (7S,10S)-10-(hydroxymethyl)-24-nitro-2,8,11-trioxo-3,9,12,20-tetrazatetracyclo[19.4.0.03,7.013,18]pentacosa-1(21),13(18),14,16,22,24-hexaene-15-carboxamide |
| SMILES | NC(=O)c1ccc2c(c1)NC(=O)[C@H](CO)NC(=O)[C@@H]1CCCN1C(=O)c1cc([N+](=O)[O-])ccc1NC2 |
| InChI | InChI=1S/C23H24N6O7/c24-20(31)12-3-4-13-10-25-16-6-5-14(29(35)36)9-15(16)23(34)28-7-1-2-19(28)22(33)27-18(11-30)21(32)26-17(13)8-12/h3-6,8-9,18-19,25,30H,1-2,7,10-11H2,(H2,24,31)(H,26,32)(H,27,33)/t18-,19-/m0/s1 |
| InChIKey | DDDKELQLBVGSOM-OALUTQOASA-N |
| XLogP | 0.34 |
| TPSA | 197.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.48 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|