C29H24N2O3S2 — CID 11214429
N-[2-[[1-(benzenesulfonyl)-3-phenylsulfanylindol-2-yl]methyl]phenyl]acetamide (PubChem CID 11214429) has the molecular formula C29H24N2O3S2 and a molecular weight of 512.66 g/mol. Its IUPAC name is N-[2-[[1-(benzenesulfonyl)-3-phenylsulfanylindol-2-yl]methyl]phenyl]acetamide.
| Compound Name | N-[2-[[1-(benzenesulfonyl)-3-phenylsulfanylindol-2-yl]methyl]phenyl]acetamide |
|---|---|
| PubChem CID | 11214429 |
| Molecular Formula | C29H24N2O3S2 |
| Molecular Weight | 512.66 g/mol |
| Exact Mass | 512.12 |
| IUPAC Name | N-[2-[[1-(benzenesulfonyl)-3-phenylsulfanylindol-2-yl]methyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccccc1Cc1c(Sc2ccccc2)c2ccccc2n1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C29H24N2O3S2/c1-21(32)30-26-18-10-8-12-22(26)20-28-29(35-23-13-4-2-5-14-23)25-17-9-11-19-27(25)31(28)36(33,34)24-15-6-3-7-16-24/h2-19H,20H2,1H3,(H,30,32) |
| InChIKey | LHMDDJLMYWISFX-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.66 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |