C28H36O6SSi — CID 11214697
[(2S,4S)-4-[tert-butyl(diphenyl)silyl]oxy-2,5-dihydroxypentyl] 4-methylbenzenesulfonate (PubChem CID 11214697) has the molecular formula C28H36O6SSi and a molecular weight of 528.74 g/mol. Its IUPAC name is [(2S,4S)-4-[tert-butyl(diphenyl)silyl]oxy-2,5-dihydroxypentyl] 4-methylbenzenesulfonate.
| Compound Name | [(2S,4S)-4-[tert-butyl(diphenyl)silyl]oxy-2,5-dihydroxypentyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 11214697 |
| Molecular Formula | C28H36O6SSi |
| Molecular Weight | 528.74 g/mol |
| Exact Mass | 528.20 |
| IUPAC Name | [(2S,4S)-4-[tert-butyl(diphenyl)silyl]oxy-2,5-dihydroxypentyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@@H](O)C[C@@H](CO)O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)cc1 |
| InChI | InChI=1S/C28H36O6SSi/c1-22-15-17-25(18-16-22)35(31,32)33-21-23(30)19-24(20-29)34-36(28(2,3)4,26-11-7-5-8-12-26)27-13-9-6-10-14-27/h5-18,23-24,29-30H,19-21H2,1-4H3/t23-,24-/m0/s1 |
| InChIKey | GIQAIXCBAJKHHE-ZEQRLZLVSA-N |
| XLogP | 3.39 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.74 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|