C27H33F6N3O — CID 11214704
trans-(1S,3R)-N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-3-[[4-(dimethylamino)phenyl]methylamino]-1-propan-2-ylcyclopentane-1-carboxamide (PubChem CID 11214704) has the molecular formula C27H33F6N3O and a molecular weight of 529.57 g/mol. Its IUPAC name is trans-(1S,3R)-N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-3-[[4-(dimethylamino)phenyl]methylamino]-1-propan-2-ylcyclopentane-1-carboxamide.
| Compound Name | trans-(1S,3R)-N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-3-[[4-(dimethylamino)phenyl]methylamino]-1-propan-2-ylcyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 11214704 |
| Molecular Formula | C27H33F6N3O |
| Molecular Weight | 529.57 g/mol |
| Exact Mass | 529.25 |
| IUPAC Name | trans-(1S,3R)-N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-3-[[4-(dimethylamino)phenyl]methylamino]-1-propan-2-ylcyclopentane-1-carboxamide |
| SMILES | CC(C)[C@]1(C(=O)NCc2cc(C(F)(F)F)cc(C(F)(F)F)c2)CC[C@@H](NCc2ccc(N(C)C)cc2)C1 |
| InChI | InChI=1S/C27H33F6N3O/c1-17(2)25(10-9-22(14-25)34-15-18-5-7-23(8-6-18)36(3)4)24(37)35-16-19-11-20(26(28,29)30)13-21(12-19)27(31,32)33/h5-8,11-13,17,22,34H,9-10,14-16H2,1-4H3,(H,35,37)/t22-,25+/m1/s1 |
| InChIKey | SOVUKGXMOCBFQJ-RDGATRHJSA-N |
| XLogP | 6.39 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.57 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|