C31H34O6S — CID 11214771
S-[(2R,3R,4R,5S,6R)-6-(2-oxoethyl)-4,5-bis(phenylmethoxy)-2-(phenylmethoxymethyl)oxan-3-yl] ethanethioate (PubChem CID 11214771) has the molecular formula C31H34O6S and a molecular weight of 534.67 g/mol. Its IUPAC name is S-[(2R,3R,4R,5S,6R)-6-(2-oxoethyl)-4,5-bis(phenylmethoxy)-2-(phenylmethoxymethyl)oxan-3-yl] ethanethioate.
| Compound Name | S-[(2R,3R,4R,5S,6R)-6-(2-oxoethyl)-4,5-bis(phenylmethoxy)-2-(phenylmethoxymethyl)oxan-3-yl] ethanethioate |
|---|---|
| PubChem CID | 11214771 |
| Molecular Formula | C31H34O6S |
| Molecular Weight | 534.67 g/mol |
| Exact Mass | 534.21 |
| IUPAC Name | S-[(2R,3R,4R,5S,6R)-6-(2-oxoethyl)-4,5-bis(phenylmethoxy)-2-(phenylmethoxymethyl)oxan-3-yl] ethanethioate |
| SMILES | CC(=O)S[C@H]1[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H](CC=O)O[C@@H]1COCc1ccccc1 |
| InChI | InChI=1S/C31H34O6S/c1-23(33)38-31-28(22-34-19-24-11-5-2-6-12-24)37-27(17-18-32)29(35-20-25-13-7-3-8-14-25)30(31)36-21-26-15-9-4-10-16-26/h2-16,18,27-31H,17,19-22H2,1H3/t27-,28-,29+,30-,31-/m1/s1 |
| InChIKey | LSSRRTWXXSFCAG-PXPWAULYSA-N |
| XLogP | 5.38 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.67 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|