C35H53NO6Si — CID 11215648
tert-butyl N-[(2S)-1-[tert-butyl(diphenyl)silyl]oxy-10-(2-methyl-1,3-dioxolan-2-yl)-5-oxodecan-2-yl]carbamate (PubChem CID 11215648) has the molecular formula C35H53NO6Si and a molecular weight of 611.90 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[tert-butyl(diphenyl)silyl]oxy-10-(2-methyl-1,3-dioxolan-2-yl)-5-oxodecan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[tert-butyl(diphenyl)silyl]oxy-10-(2-methyl-1,3-dioxolan-2-yl)-5-oxodecan-2-yl]carbamate |
|---|---|
| PubChem CID | 11215648 |
| Molecular Formula | C35H53NO6Si |
| Molecular Weight | 611.90 g/mol |
| Exact Mass | 611.36 |
| IUPAC Name | tert-butyl N-[(2S)-1-[tert-butyl(diphenyl)silyl]oxy-10-(2-methyl-1,3-dioxolan-2-yl)-5-oxodecan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCC(=O)CCCCCC1(C)OCCO1)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C35H53NO6Si/c1-33(2,3)42-32(38)36-28(22-23-29(37)17-11-10-16-24-35(7)39-25-26-40-35)27-41-43(34(4,5)6,30-18-12-8-13-19-30)31-20-14-9-15-21-31/h8-9,12-15,18-21,28H,10-11,16-17,22-27H2,1-7H3,(H,36,38)/t28-/m0/s1 |
| InChIKey | IVUXNQLUQCVMEY-NDEPHWFRSA-N |
| XLogP | 6.52 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.90 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|