C37H59N3O5Si — CID 134865038
tert-butyl N-[(2S,6E)-1-[tert-butyl(diphenyl)silyl]oxy-9-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-6-(dimethylhydrazinylidene)nonan-2-yl]carbamate (PubChem CID 134865038) has the molecular formula C37H59N3O5Si and a molecular weight of 653.98 g/mol. Its IUPAC name is tert-butyl N-[(2S,6E)-1-[tert-butyl(diphenyl)silyl]oxy-9-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-6-(dimethylhydrazinylidene)nonan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,6E)-1-[tert-butyl(diphenyl)silyl]oxy-9-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-6-(dimethylhydrazinylidene)nonan-2-yl]carbamate |
|---|---|
| PubChem CID | 134865038 |
| Molecular Formula | C37H59N3O5Si |
| Molecular Weight | 653.98 g/mol |
| Exact Mass | 653.42 |
| IUPAC Name | tert-butyl N-[(2S,6E)-1-[tert-butyl(diphenyl)silyl]oxy-9-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-6-(dimethylhydrazinylidene)nonan-2-yl]carbamate |
| SMILES | CN(C)/N=C(\CCC[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)NC(=O)OC(C)(C)C)CCC[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C37H59N3O5Si/c1-35(2,3)45-34(41)38-30(21-17-19-29(39-40(9)10)20-18-22-31-28-42-37(7,8)44-31)27-43-46(36(4,5)6,32-23-13-11-14-24-32)33-25-15-12-16-26-33/h11-16,23-26,30-31H,17-22,27-28H2,1-10H3,(H,38,41)/b39-29+/t30-,31-/m0/s1 |
| InChIKey | ZAIAFQHQVFUIFO-WZQRSYNESA-N |
| XLogP | 6.87 |
| TPSA | 81.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.98 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|