C35H53NO6Si — CID 134865010
tert-butyl N-[(2S)-1-[tert-butyl(diphenyl)silyl]oxy-9-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-6-oxononan-2-yl]carbamate (PubChem CID 134865010) has the molecular formula C35H53NO6Si and a molecular weight of 611.90 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[tert-butyl(diphenyl)silyl]oxy-9-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-6-oxononan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[tert-butyl(diphenyl)silyl]oxy-9-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-6-oxononan-2-yl]carbamate |
|---|---|
| PubChem CID | 134865010 |
| Molecular Formula | C35H53NO6Si |
| Molecular Weight | 611.90 g/mol |
| Exact Mass | 611.36 |
| IUPAC Name | tert-butyl N-[(2S)-1-[tert-butyl(diphenyl)silyl]oxy-9-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-6-oxononan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCCC(=O)CCC[C@H]1COC(C)(C)O1)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C35H53NO6Si/c1-33(2,3)42-32(38)36-27(17-15-18-28(37)19-16-20-29-26-39-35(7,8)41-29)25-40-43(34(4,5)6,30-21-11-9-12-22-30)31-23-13-10-14-24-31/h9-14,21-24,27,29H,15-20,25-26H2,1-8H3,(H,36,38)/t27-,29-/m0/s1 |
| InChIKey | ZPMHFSTXRTWGRE-YTMVLYRLSA-N |
| XLogP | 6.52 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.90 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|