C32H48N2O6Si — CID 123812780
tert-butyl N-[6-[tert-butyl(diphenyl)silyl]oxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]carbamate (PubChem CID 123812780) has the molecular formula C32H48N2O6Si and a molecular weight of 584.83 g/mol. Its IUPAC name is tert-butyl N-[6-[tert-butyl(diphenyl)silyl]oxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]carbamate.
| Compound Name | tert-butyl N-[6-[tert-butyl(diphenyl)silyl]oxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]carbamate |
|---|---|
| PubChem CID | 123812780 |
| Molecular Formula | C32H48N2O6Si |
| Molecular Weight | 584.83 g/mol |
| Exact Mass | 584.33 |
| IUPAC Name | tert-butyl N-[6-[tert-butyl(diphenyl)silyl]oxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(=O)CCCC(CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C32H48N2O6Si/c1-30(2,3)39-28(36)33-24(17-16-22-27(35)34-29(37)40-31(4,5)6)23-38-41(32(7,8)9,25-18-12-10-13-19-25)26-20-14-11-15-21-26/h10-15,18-21,24H,16-17,22-23H2,1-9H3,(H,33,36)(H,34,35,37) |
| InChIKey | BBNQVQGLXDRBST-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.83 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|