C32H30BrN5O9S — CID 11216360
methyl 5-(7-bromo-1H-indol-3-yl)-2-[(1S)-1-[[(2S)-3-(4-hydroxyphenyl)-2-[(2-nitrophenyl)sulfonylamino]propanoyl]amino]-2-methylpropyl]-1,3-oxazole-4-carboxylate (PubChem CID 11216360) has the molecular formula C32H30BrN5O9S and a molecular weight of 740.59 g/mol. Its IUPAC name is methyl 5-(7-bromo-1H-indol-3-yl)-2-[(1S)-1-[[(2S)-3-(4-hydroxyphenyl)-2-[(2-nitrophenyl)sulfonylamino]propanoyl]amino]-2-methylpropyl]-1,3-oxazole-4-carboxylate.
| Compound Name | methyl 5-(7-bromo-1H-indol-3-yl)-2-[(1S)-1-[[(2S)-3-(4-hydroxyphenyl)-2-[(2-nitrophenyl)sulfonylamino]propanoyl]amino]-2-methylpropyl]-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 11216360 |
| Molecular Formula | C32H30BrN5O9S |
| Molecular Weight | 740.59 g/mol |
| Exact Mass | 739.09 |
| IUPAC Name | methyl 5-(7-bromo-1H-indol-3-yl)-2-[(1S)-1-[[(2S)-3-(4-hydroxyphenyl)-2-[(2-nitrophenyl)sulfonylamino]propanoyl]amino]-2-methylpropyl]-1,3-oxazole-4-carboxylate |
| SMILES | COC(=O)c1nc([C@@H](NC(=O)[C@H](Cc2ccc(O)cc2)NS(=O)(=O)c2ccccc2[N+](=O)[O-])C(C)C)oc1-c1c[nH]c2c(Br)cccc12 |
| InChI | InChI=1S/C32H30BrN5O9S/c1-17(2)26(31-36-28(32(41)46-3)29(47-31)21-16-34-27-20(21)7-6-8-22(27)33)35-30(40)23(15-18-11-13-19(39)14-12-18)37-48(44,45)25-10-5-4-9-24(25)38(42)43/h4-14,16-17,23,26,34,37,39H,15H2,1-3H3,(H,35,40)/t23-,26-/m0/s1 |
| InChIKey | UBRXKFPGSRQQJH-OZXSUGGESA-N |
| XLogP | 5.39 |
| TPSA | 206.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.59 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|