About 1-prop-2-ynoxybuta-2,3-dienylbenzene
1-prop-2-ynoxybuta-2,3-dienylbenzene (PubChem CID 11217642) has the molecular formula C13H12O
and a molecular weight of 184.24 g/mol. Its IUPAC name is 1-prop-2-ynoxybuta-2,3-dienylbenzene.
Molecular Properties
| Compound Name | 1-prop-2-ynoxybuta-2,3-dienylbenzene |
| PubChem CID | 11217642 |
| Molecular Formula | C13H12O |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.09 |
| IUPAC Name | 1-prop-2-ynoxybuta-2,3-dienylbenzene |
| SMILES | C#CCOC(C=C=C)c1ccccc1 |
| InChI | InChI=1S/C13H12O/c1-3-8-13(14-11-4-2)12-9-6-5-7-10-12/h2,5-10,13H,1,11H2 |
| InChIKey | PBEOFDMAUAEKEO-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-prop-2-ynoxybuta-2,3-dienylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-prop-2-ynoxybuta-2,3-dienylbenzene?
The IUPAC name of 1-prop-2-ynoxybuta-2,3-dienylbenzene (CID 11217642) is 1-prop-2-ynoxybuta-2,3-dienylbenzene.
What is the SMILES notation for 1-prop-2-ynoxybuta-2,3-dienylbenzene?
The canonical SMILES for 1-prop-2-ynoxybuta-2,3-dienylbenzene is C#CCOC(C=C=C)c1ccccc1.
What is the InChIKey of 1-prop-2-ynoxybuta-2,3-dienylbenzene?
The InChIKey is PBEOFDMAUAEKEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12O/c1-3-8-13(14-11-4-2)12-9-6-5-7-10-12/h2,5-10,13H,1,11H2.
What are the key properties of 1-prop-2-ynoxybuta-2,3-dienylbenzene?
1-prop-2-ynoxybuta-2,3-dienylbenzene has a molecular weight of 184.24 g/mol, XLogP of 2.72, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-prop-2-ynoxybuta-2,3-dienylbenzene is sourced from PubChem (CID 11217642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).