C17H18INO — CID 11291899
1-(1-methoxy-2-phenylpenta-3,4-dienyl)pyridin-1-ium iodide (PubChem CID 11291899) has the molecular formula C17H18INO and a molecular weight of 379.24 g/mol. Its IUPAC name is 1-(1-methoxy-2-phenylpenta-3,4-dienyl)pyridin-1-ium iodide.
| Compound Name | 1-(1-methoxy-2-phenylpenta-3,4-dienyl)pyridin-1-ium iodide |
|---|---|
| PubChem CID | 11291899 |
| Molecular Formula | C17H18INO |
| Molecular Weight | 379.24 g/mol |
| Exact Mass | 379.04 |
| IUPAC Name | 1-(1-methoxy-2-phenylpenta-3,4-dienyl)pyridin-1-ium iodide |
| SMILES | C=C=CC(c1ccccc1)C(OC)[n+]1ccccc1.[I-] |
| InChI | InChI=1S/C17H18NO.HI/c1-3-10-16(15-11-6-4-7-12-15)17(19-2)18-13-8-5-9-14-18;/h4-14,16-17H,1H2,2H3;1H/q+1;/p-1 |
| InChIKey | UFLGSYJMCNVJOE-UHFFFAOYSA-M |
| XLogP | 0.25 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.24 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|