C9H13FO3 — CID 11217694
ethyl 2-fluoro-2-[(1R,2S,5S)-6-oxabicyclo[3.1.0]hexan-2-yl]acetate (PubChem CID 11217694) has the molecular formula C9H13FO3 and a molecular weight of 188.20 g/mol. Its IUPAC name is ethyl 2-fluoro-2-[(1R,2S,5S)-6-oxabicyclo[3.1.0]hexan-2-yl]acetate.
| Compound Name | ethyl 2-fluoro-2-[(1R,2S,5S)-6-oxabicyclo[3.1.0]hexan-2-yl]acetate |
|---|---|
| PubChem CID | 11217694 |
| Molecular Formula | C9H13FO3 |
| Molecular Weight | 188.20 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | ethyl 2-fluoro-2-[(1R,2S,5S)-6-oxabicyclo[3.1.0]hexan-2-yl]acetate |
| SMILES | CCOC(=O)C(F)[C@H]1CC[C@@H]2O[C@@H]21 |
| InChI | InChI=1S/C9H13FO3/c1-2-12-9(11)7(10)5-3-4-6-8(5)13-6/h5-8H,2-4H2,1H3/t5-,6+,7?,8-/m1/s1 |
| InChIKey | KHHLYQMKTOKJQS-JJFBUQMESA-N |
| XLogP | 1.07 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.20 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|