C19H20N2O2 — CID 11220556
4,5,5-trimethyl-1-oxido-2-(4-phenylmethoxyphenyl)imidazol-1-ium (PubChem CID 11220556) has the molecular formula C19H20N2O2 and a molecular weight of 308.38 g/mol. Its IUPAC name is 4,5,5-trimethyl-1-oxido-2-(4-phenylmethoxyphenyl)imidazol-1-ium.
| Compound Name | 4,5,5-trimethyl-1-oxido-2-(4-phenylmethoxyphenyl)imidazol-1-ium |
|---|---|
| PubChem CID | 11220556 |
| Molecular Formula | C19H20N2O2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | 4,5,5-trimethyl-1-oxido-2-(4-phenylmethoxyphenyl)imidazol-1-ium |
| SMILES | CC1=NC(c2ccc(OCc3ccccc3)cc2)=[N+]([O-])C1(C)C |
| InChI | InChI=1S/C19H20N2O2/c1-14-19(2,3)21(22)18(20-14)16-9-11-17(12-10-16)23-13-15-7-5-4-6-8-15/h4-12H,13H2,1-3H3 |
| InChIKey | LWEAWPXEGPOYTF-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 47.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|