C18H21NO4 — CID 11220777
tert-butyl (1R,2R,6S,7S)-4-phenyl-3,5-dioxa-10-azatricyclo[5.2.1.02,6]dec-8-ene-10-carboxylate (PubChem CID 11220777) has the molecular formula C18H21NO4 and a molecular weight of 315.37 g/mol. Its IUPAC name is tert-butyl (1R,2R,6S,7S)-4-phenyl-3,5-dioxa-10-azatricyclo[5.2.1.02,6]dec-8-ene-10-carboxylate.
| Compound Name | tert-butyl (1R,2R,6S,7S)-4-phenyl-3,5-dioxa-10-azatricyclo[5.2.1.02,6]dec-8-ene-10-carboxylate |
|---|---|
| PubChem CID | 11220777 |
| Molecular Formula | C18H21NO4 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | tert-butyl (1R,2R,6S,7S)-4-phenyl-3,5-dioxa-10-azatricyclo[5.2.1.02,6]dec-8-ene-10-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@@H]2C=C[C@H]1[C@@H]1OC(c3ccccc3)O[C@@H]12 |
| InChI | InChI=1S/C18H21NO4/c1-18(2,3)23-17(20)19-12-9-10-13(19)15-14(12)21-16(22-15)11-7-5-4-6-8-11/h4-10,12-16H,1-3H3/t12-,13+,14-,15+,16? |
| InChIKey | TWFPMHRFBNZOMX-GJZITSJHSA-N |
| XLogP | 3.03 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|