C23H31FOSi — CID 11222478
triethyl-[(S)-[(1S)-1-(4-fluorophenyl)but-3-enoxy]-phenylmethyl]silane (PubChem CID 11222478) has the molecular formula C23H31FOSi and a molecular weight of 370.58 g/mol. Its IUPAC name is triethyl-[(S)-[(1S)-1-(4-fluorophenyl)but-3-enoxy]-phenylmethyl]silane.
| Compound Name | triethyl-[(S)-[(1S)-1-(4-fluorophenyl)but-3-enoxy]-phenylmethyl]silane |
|---|---|
| PubChem CID | 11222478 |
| Molecular Formula | C23H31FOSi |
| Molecular Weight | 370.58 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | triethyl-[(S)-[(1S)-1-(4-fluorophenyl)but-3-enoxy]-phenylmethyl]silane |
| SMILES | C=CC[C@H](O[C@H](c1ccccc1)[Si](CC)(CC)CC)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H31FOSi/c1-5-12-22(19-15-17-21(24)18-16-19)25-23(20-13-10-9-11-14-20)26(6-2,7-3)8-4/h5,9-11,13-18,22-23H,1,6-8,12H2,2-4H3/t22-,23-/m0/s1 |
| InChIKey | VYDJQGJVFWSEJK-GOTSBHOMSA-N |
| XLogP | 7.25 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.58 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|