C19H19FO — CID 132607653
1-fluoro-4-[(1R,2S)-2-phenyl-1-prop-2-enoxybut-3-enyl]benzene (PubChem CID 132607653) has the molecular formula C19H19FO and a molecular weight of 282.36 g/mol. Its IUPAC name is 1-fluoro-4-[(1R,2S)-2-phenyl-1-prop-2-enoxybut-3-enyl]benzene.
| Compound Name | 1-fluoro-4-[(1R,2S)-2-phenyl-1-prop-2-enoxybut-3-enyl]benzene |
|---|---|
| PubChem CID | 132607653 |
| Molecular Formula | C19H19FO |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 1-fluoro-4-[(1R,2S)-2-phenyl-1-prop-2-enoxybut-3-enyl]benzene |
| SMILES | C=CCO[C@@H](c1ccc(F)cc1)[C@@H](C=C)c1ccccc1 |
| InChI | InChI=1S/C19H19FO/c1-3-14-21-19(16-10-12-17(20)13-11-16)18(4-2)15-8-6-5-7-9-15/h3-13,18-19H,1-2,14H2/t18-,19-/m0/s1 |
| InChIKey | RFBAXMKRRVLQSW-OALUTQOASA-N |
| XLogP | 5.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|