C16H21NO5S2 — CID 11222497
N,N-dimethyl-1-[2-(4-methylsulfanylphenoxy)phenyl]methanamine;sulfuric acid (PubChem CID 11222497) has the molecular formula C16H21NO5S2 and a molecular weight of 371.48 g/mol. Its IUPAC name is N,N-dimethyl-1-[2-(4-methylsulfanylphenoxy)phenyl]methanamine;sulfuric acid.
| Compound Name | N,N-dimethyl-1-[2-(4-methylsulfanylphenoxy)phenyl]methanamine;sulfuric acid |
|---|---|
| PubChem CID | 11222497 |
| Molecular Formula | C16H21NO5S2 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | N,N-dimethyl-1-[2-(4-methylsulfanylphenoxy)phenyl]methanamine;sulfuric acid |
| SMILES | CSc1ccc(Oc2ccccc2CN(C)C)cc1.O=S(=O)(O)O |
| InChI | InChI=1S/C16H19NOS.H2O4S/c1-17(2)12-13-6-4-5-7-16(13)18-14-8-10-15(19-3)11-9-14;1-5(2,3)4/h4-11H,12H2,1-3H3;(H2,1,2,3,4) |
| InChIKey | HHEVJGWPPMHBAS-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|