C19H26N2O2S — CID 23378669
2-[3-[(dimethylamino)methyl]-N-methyl-4-(4-methylsulfanylphenoxy)anilino]ethanol (PubChem CID 23378669) has the molecular formula C19H26N2O2S and a molecular weight of 346.50 g/mol. Its IUPAC name is 2-[3-[(dimethylamino)methyl]-N-methyl-4-(4-methylsulfanylphenoxy)anilino]ethanol.
| Compound Name | 2-[3-[(dimethylamino)methyl]-N-methyl-4-(4-methylsulfanylphenoxy)anilino]ethanol |
|---|---|
| PubChem CID | 23378669 |
| Molecular Formula | C19H26N2O2S |
| Molecular Weight | 346.50 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | 2-[3-[(dimethylamino)methyl]-N-methyl-4-(4-methylsulfanylphenoxy)anilino]ethanol |
| SMILES | CSc1ccc(Oc2ccc(N(C)CCO)cc2CN(C)C)cc1 |
| InChI | InChI=1S/C19H26N2O2S/c1-20(2)14-15-13-16(21(3)11-12-22)5-10-19(15)23-17-6-8-18(24-4)9-7-17/h5-10,13,22H,11-12,14H2,1-4H3 |
| InChIKey | COOXKEAYRZSPPS-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.50 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |