C17H23NO4S2 — CID 11440104
N,N-dimethyl-1-[2-(4-methylsulfanylphenoxy)phenyl]methanamine;methanesulfonic acid (PubChem CID 11440104) has the molecular formula C17H23NO4S2 and a molecular weight of 369.51 g/mol. Its IUPAC name is N,N-dimethyl-1-[2-(4-methylsulfanylphenoxy)phenyl]methanamine;methanesulfonic acid.
| Compound Name | N,N-dimethyl-1-[2-(4-methylsulfanylphenoxy)phenyl]methanamine;methanesulfonic acid |
|---|---|
| PubChem CID | 11440104 |
| Molecular Formula | C17H23NO4S2 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | N,N-dimethyl-1-[2-(4-methylsulfanylphenoxy)phenyl]methanamine;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.CSc1ccc(Oc2ccccc2CN(C)C)cc1 |
| InChI | InChI=1S/C16H19NOS.CH4O3S/c1-17(2)12-13-6-4-5-7-16(13)18-14-8-10-15(19-3)11-9-14;1-5(2,3)4/h4-11H,12H2,1-3H3;1H3,(H,2,3,4) |
| InChIKey | UQOPKKQXIQKLGZ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|