C23H23N5O2 — CID 11223348
8-[(E)-3-(1H-indazol-3-yl)prop-2-enoyl]-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one (PubChem CID 11223348) has the molecular formula C23H23N5O2 and a molecular weight of 401.47 g/mol. Its IUPAC name is 8-[(E)-3-(1H-indazol-3-yl)prop-2-enoyl]-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one.
| Compound Name | 8-[(E)-3-(1H-indazol-3-yl)prop-2-enoyl]-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one |
|---|---|
| PubChem CID | 11223348 |
| Molecular Formula | C23H23N5O2 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | 8-[(E)-3-(1H-indazol-3-yl)prop-2-enoyl]-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one |
| SMILES | O=C(/C=C/c1n[nH]c2ccccc12)N1CCC2(CC1)C(=O)NCN2c1ccccc1 |
| InChI | InChI=1S/C23H23N5O2/c29-21(11-10-20-18-8-4-5-9-19(18)25-26-20)27-14-12-23(13-15-27)22(30)24-16-28(23)17-6-2-1-3-7-17/h1-11H,12-16H2,(H,24,30)(H,25,26)/b11-10+ |
| InChIKey | CVJXCMJIXQTKPH-ZHACJKMWSA-N |
| XLogP | 2.53 |
| TPSA | 81.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|