C22H23ClN4O2 — CID 11223627
5-chloro-2-[7-(1,3-dimethoxypropan-2-yl)-10-methyl-2,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraen-2-yl]benzonitrile (PubChem CID 11223627) has the molecular formula C22H23ClN4O2 and a molecular weight of 410.91 g/mol. Its IUPAC name is 5-chloro-2-[7-(1,3-dimethoxypropan-2-yl)-10-methyl-2,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraen-2-yl]benzonitrile.
| Compound Name | 5-chloro-2-[7-(1,3-dimethoxypropan-2-yl)-10-methyl-2,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraen-2-yl]benzonitrile |
|---|---|
| PubChem CID | 11223627 |
| Molecular Formula | C22H23ClN4O2 |
| Molecular Weight | 410.91 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | 5-chloro-2-[7-(1,3-dimethoxypropan-2-yl)-10-methyl-2,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraen-2-yl]benzonitrile |
| SMILES | COCC(COC)N1CCc2cn(-c3ccc(Cl)cc3C#N)c3nc(C)cc1c23 |
| InChI | InChI=1S/C22H23ClN4O2/c1-14-8-20-21-15(6-7-26(20)18(12-28-2)13-29-3)11-27(22(21)25-14)19-5-4-17(23)9-16(19)10-24/h4-5,8-9,11,18H,6-7,12-13H2,1-3H3 |
| InChIKey | KGRZFTNWJXLMEH-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 63.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.91 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |