C25H27NO3S — CID 11223942
4-methyl-N-(2-phenylethyl)-N-(1-phenylmethoxyprop-2-enyl)benzenesulfonamide (PubChem CID 11223942) has the molecular formula C25H27NO3S and a molecular weight of 421.56 g/mol. Its IUPAC name is 4-methyl-N-(2-phenylethyl)-N-(1-phenylmethoxyprop-2-enyl)benzenesulfonamide.
| Compound Name | 4-methyl-N-(2-phenylethyl)-N-(1-phenylmethoxyprop-2-enyl)benzenesulfonamide |
|---|---|
| PubChem CID | 11223942 |
| Molecular Formula | C25H27NO3S |
| Molecular Weight | 421.56 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | 4-methyl-N-(2-phenylethyl)-N-(1-phenylmethoxyprop-2-enyl)benzenesulfonamide |
| SMILES | C=CC(OCc1ccccc1)N(CCc1ccccc1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C25H27NO3S/c1-3-25(29-20-23-12-8-5-9-13-23)26(19-18-22-10-6-4-7-11-22)30(27,28)24-16-14-21(2)15-17-24/h3-17,25H,1,18-20H2,2H3 |
| InChIKey | YPUOMVJCABLAMV-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.56 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|