C15H22Br2O5 — CID 11224508
(4R,5S,6R)-4-(3,3-dibromoprop-2-enyl)-5-methoxy-6-[(4S,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]oxan-2-one (PubChem CID 11224508) has the molecular formula C15H22Br2O5 and a molecular weight of 442.14 g/mol. Its IUPAC name is (4R,5S,6R)-4-(3,3-dibromoprop-2-enyl)-5-methoxy-6-[(4S,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]oxan-2-one.
| Compound Name | (4R,5S,6R)-4-(3,3-dibromoprop-2-enyl)-5-methoxy-6-[(4S,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]oxan-2-one |
|---|---|
| PubChem CID | 11224508 |
| Molecular Formula | C15H22Br2O5 |
| Molecular Weight | 442.14 g/mol |
| Exact Mass | 439.98 |
| IUPAC Name | (4R,5S,6R)-4-(3,3-dibromoprop-2-enyl)-5-methoxy-6-[(4S,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]oxan-2-one |
| SMILES | CO[C@H]1[C@H](CC=C(Br)Br)CC(=O)O[C@H]1[C@H]1OC(C)(C)O[C@@H]1C |
| InChI | InChI=1S/C15H22Br2O5/c1-8-12(22-15(2,3)21-8)14-13(19-4)9(5-6-10(16)17)7-11(18)20-14/h6,8-9,12-14H,5,7H2,1-4H3/t8-,9-,12+,13+,14+/m1/s1 |
| InChIKey | UVUHNCPTQSPYBC-IZPVPAKOSA-N |
| XLogP | 3.49 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.14 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |