C34H41NO2S — CID 11226302
4-methoxy-N-[(1S)-1-[1-[(R)-[2,4,6-tri(propan-2-yl)phenyl]sulfinyl]naphthalen-2-yl]ethyl]aniline (PubChem CID 11226302) has the molecular formula C34H41NO2S and a molecular weight of 527.77 g/mol. Its IUPAC name is 4-methoxy-N-[(1S)-1-[1-[(R)-[2,4,6-tri(propan-2-yl)phenyl]sulfinyl]naphthalen-2-yl]ethyl]aniline.
| Compound Name | 4-methoxy-N-[(1S)-1-[1-[(R)-[2,4,6-tri(propan-2-yl)phenyl]sulfinyl]naphthalen-2-yl]ethyl]aniline |
|---|---|
| PubChem CID | 11226302 |
| Molecular Formula | C34H41NO2S |
| Molecular Weight | 527.77 g/mol |
| Exact Mass | 527.29 |
| IUPAC Name | 4-methoxy-N-[(1S)-1-[1-[(R)-[2,4,6-tri(propan-2-yl)phenyl]sulfinyl]naphthalen-2-yl]ethyl]aniline |
| SMILES | COc1ccc(N[C@@H](C)c2ccc3ccccc3c2[S@](=O)c2c(C(C)C)cc(C(C)C)cc2C(C)C)cc1 |
| InChI | InChI=1S/C34H41NO2S/c1-21(2)26-19-31(22(3)4)34(32(20-26)23(5)6)38(36)33-29(18-13-25-11-9-10-12-30(25)33)24(7)35-27-14-16-28(37-8)17-15-27/h9-24,35H,1-8H3/t24-,38-/m0/s1 |
| InChIKey | ZYUZPOXJFTZKOB-OZVCKUFTSA-N |
| XLogP | 9.56 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.77 |
| LogP ≤ 5 | 9.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|