C30H39F3O2SSi — CID 101389355
trimethyl-[(1S)-2,2,2-trifluoro-1-[1-[2,4,6-tri(propan-2-yl)phenyl]sulfinylnaphthalen-2-yl]ethoxy]silane (PubChem CID 101389355) has the molecular formula C30H39F3O2SSi and a molecular weight of 548.79 g/mol. Its IUPAC name is trimethyl-[(1S)-2,2,2-trifluoro-1-[1-[2,4,6-tri(propan-2-yl)phenyl]sulfinylnaphthalen-2-yl]ethoxy]silane.
| Compound Name | trimethyl-[(1S)-2,2,2-trifluoro-1-[1-[2,4,6-tri(propan-2-yl)phenyl]sulfinylnaphthalen-2-yl]ethoxy]silane |
|---|---|
| PubChem CID | 101389355 |
| Molecular Formula | C30H39F3O2SSi |
| Molecular Weight | 548.79 g/mol |
| Exact Mass | 548.24 |
| IUPAC Name | trimethyl-[(1S)-2,2,2-trifluoro-1-[1-[2,4,6-tri(propan-2-yl)phenyl]sulfinylnaphthalen-2-yl]ethoxy]silane |
| SMILES | CC(C)c1cc(C(C)C)c(S(=O)c2c([C@H](O[Si](C)(C)C)C(F)(F)F)ccc3ccccc23)c(C(C)C)c1 |
| InChI | InChI=1S/C30H39F3O2SSi/c1-18(2)22-16-25(19(3)4)28(26(17-22)20(5)6)36(34)27-23-13-11-10-12-21(23)14-15-24(27)29(30(31,32)33)35-37(7,8)9/h10-20,29H,1-9H3/t29-,36?/m0/s1 |
| InChIKey | NBEPRDHNOARGNE-FIMWSPJOSA-N |
| XLogP | 9.83 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.79 |
| LogP ≤ 5 | 9.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|