C33H34O13 — CID 11227482
[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[4-[(1E,3Z,6E)-3-hydroxy-7-(4-hydroxyphenyl)-5-oxohepta-1,3,6-trienyl]phenoxy]oxan-2-yl]methyl acetate (PubChem CID 11227482) has the molecular formula C33H34O13 and a molecular weight of 638.62 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[4-[(1E,3Z,6E)-3-hydroxy-7-(4-hydroxyphenyl)-5-oxohepta-1,3,6-trienyl]phenoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[4-[(1E,3Z,6E)-3-hydroxy-7-(4-hydroxyphenyl)-5-oxohepta-1,3,6-trienyl]phenoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 11227482 |
| Molecular Formula | C33H34O13 |
| Molecular Weight | 638.62 g/mol |
| Exact Mass | 638.20 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[4-[(1E,3Z,6E)-3-hydroxy-7-(4-hydroxyphenyl)-5-oxohepta-1,3,6-trienyl]phenoxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](Oc2ccc(/C=C/C(O)=C/C(=O)/C=C/c3ccc(O)cc3)cc2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C33H34O13/c1-19(34)41-18-29-30(42-20(2)35)31(43-21(3)36)32(44-22(4)37)33(46-29)45-28-15-9-24(10-16-28)8-14-27(40)17-26(39)13-7-23-5-11-25(38)12-6-23/h5-17,29-33,38,40H,18H2,1-4H3/b13-7+,14-8+,27-17-/t29-,30-,31+,32-,33-/m1/s1 |
| InChIKey | UIRJTJHLYJGJTQ-GNJPAQEVSA-N |
| XLogP | 3.59 |
| TPSA | 181.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.62 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|