C29H30O11 — CID 3787728
[3,4,5-triacetyloxy-6-[4-(3-oxo-3-phenylprop-1-enyl)phenoxy]oxan-2-yl]methyl acetate (PubChem CID 3787728) has the molecular formula C29H30O11 and a molecular weight of 554.55 g/mol. Its IUPAC name is [3,4,5-triacetyloxy-6-[4-(3-oxo-3-phenylprop-1-enyl)phenoxy]oxan-2-yl]methyl acetate.
| Compound Name | [3,4,5-triacetyloxy-6-[4-(3-oxo-3-phenylprop-1-enyl)phenoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 3787728 |
| Molecular Formula | C29H30O11 |
| Molecular Weight | 554.55 g/mol |
| Exact Mass | 554.18 |
| IUPAC Name | [3,4,5-triacetyloxy-6-[4-(3-oxo-3-phenylprop-1-enyl)phenoxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(Oc2ccc(C=CC(=O)c3ccccc3)cc2)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C29H30O11/c1-17(30)35-16-25-26(36-18(2)31)27(37-19(3)32)28(38-20(4)33)29(40-25)39-23-13-10-21(11-14-23)12-15-24(34)22-8-6-5-7-9-22/h5-15,25-29H,16H2,1-4H3 |
| InChIKey | VNFHFOIVRGNPPS-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 140.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.55 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|