C15H24O3 — CID 11230507
(1aR,2S,3aS,7S,7aR,7bS)-1a-(1-hydroxypropan-2-yl)-7,7a-dimethyl-2,3,3a,6,7,7b-hexahydronaphtho[1,2-b]oxiren-2-ol (PubChem CID 11230507) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is (1aR,2S,3aS,7S,7aR,7bS)-1a-(1-hydroxypropan-2-yl)-7,7a-dimethyl-2,3,3a,6,7,7b-hexahydronaphtho[1,2-b]oxiren-2-ol.
| Compound Name | (1aR,2S,3aS,7S,7aR,7bS)-1a-(1-hydroxypropan-2-yl)-7,7a-dimethyl-2,3,3a,6,7,7b-hexahydronaphtho[1,2-b]oxiren-2-ol |
|---|---|
| PubChem CID | 11230507 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | (1aR,2S,3aS,7S,7aR,7bS)-1a-(1-hydroxypropan-2-yl)-7,7a-dimethyl-2,3,3a,6,7,7b-hexahydronaphtho[1,2-b]oxiren-2-ol |
| SMILES | CC(CO)[C@]12O[C@H]1[C@@]1(C)[C@H](C=CC[C@@H]1C)C[C@@H]2O |
| InChI | InChI=1S/C15H24O3/c1-9-5-4-6-11-7-12(17)15(10(2)8-16)13(18-15)14(9,11)3/h4,6,9-13,16-17H,5,7-8H2,1-3H3/t9-,10?,11+,12-,13-,14+,15+/m0/s1 |
| InChIKey | ZCWZEOHAWDEBFN-QATVBQIBSA-N |
| XLogP | 1.74 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|