C16H17Cl3N2O4 — CID 1123104
2,2,2-trichloroethyl (4S)-4-(2-ethoxyphenyl)-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 1123104) has the molecular formula C16H17Cl3N2O4 and a molecular weight of 407.68 g/mol. Its IUPAC name is 2,2,2-trichloroethyl (4S)-4-(2-ethoxyphenyl)-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | 2,2,2-trichloroethyl (4S)-4-(2-ethoxyphenyl)-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 1123104 |
| Molecular Formula | C16H17Cl3N2O4 |
| Molecular Weight | 407.68 g/mol |
| Exact Mass | 406.03 |
| IUPAC Name | 2,2,2-trichloroethyl (4S)-4-(2-ethoxyphenyl)-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCOc1ccccc1[C@@H]1NC(=O)NC(C)=C1C(=O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C16H17Cl3N2O4/c1-3-24-11-7-5-4-6-10(11)13-12(9(2)20-15(23)21-13)14(22)25-8-16(17,18)19/h4-7,13H,3,8H2,1-2H3,(H2,20,21,23)/t13-/m0/s1 |
| InChIKey | OVDPOJBPBAEGIE-ZDUSSCGKSA-N |
| XLogP | 3.63 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.68 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|