C14H12Cl4N2O3 — CID 1110491
2,2,2-trichloroethyl (4R)-4-(4-chlorophenyl)-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 1110491) has the molecular formula C14H12Cl4N2O3 and a molecular weight of 398.07 g/mol. Its IUPAC name is 2,2,2-trichloroethyl (4R)-4-(4-chlorophenyl)-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | 2,2,2-trichloroethyl (4R)-4-(4-chlorophenyl)-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 1110491 |
| Molecular Formula | C14H12Cl4N2O3 |
| Molecular Weight | 398.07 g/mol |
| Exact Mass | 395.96 |
| IUPAC Name | 2,2,2-trichloroethyl (4R)-4-(4-chlorophenyl)-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CC1=C(C(=O)OCC(Cl)(Cl)Cl)[C@@H](c2ccc(Cl)cc2)NC(=O)N1 |
| InChI | InChI=1S/C14H12Cl4N2O3/c1-7-10(12(21)23-6-14(16,17)18)11(20-13(22)19-7)8-2-4-9(15)5-3-8/h2-5,11H,6H2,1H3,(H2,19,20,22)/t11-/m1/s1 |
| InChIKey | RZPFIRPDCSLXER-LLVKDONJSA-N |
| XLogP | 3.88 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.07 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|