C14H19BrO — CID 11231400
(4aR,5R,8aS)-5-(bromomethyl)-2,5,8a-trimethyl-4a,8-dihydro-4H-naphthalen-1-one (PubChem CID 11231400) has the molecular formula C14H19BrO and a molecular weight of 283.21 g/mol. Its IUPAC name is (4aR,5R,8aS)-5-(bromomethyl)-2,5,8a-trimethyl-4a,8-dihydro-4H-naphthalen-1-one.
| Compound Name | (4aR,5R,8aS)-5-(bromomethyl)-2,5,8a-trimethyl-4a,8-dihydro-4H-naphthalen-1-one |
|---|---|
| PubChem CID | 11231400 |
| Molecular Formula | C14H19BrO |
| Molecular Weight | 283.21 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | (4aR,5R,8aS)-5-(bromomethyl)-2,5,8a-trimethyl-4a,8-dihydro-4H-naphthalen-1-one |
| SMILES | CC1=CC[C@H]2[C@](C)(CBr)C=CC[C@]2(C)C1=O |
| InChI | InChI=1S/C14H19BrO/c1-10-5-6-11-13(2,9-15)7-4-8-14(11,3)12(10)16/h4-5,7,11H,6,8-9H2,1-3H3/t11-,13-,14-/m0/s1 |
| InChIKey | VUCOEIWXRUBSDD-UBHSHLNASA-N |
| XLogP | 3.89 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.21 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|