C19H30O3S2 — CID 91051487
2-[(1R,4aS,5S)-5-(1,3-dithian-2-yl)-5-hydroxy-1,4a,6-trimethyl-8,8a-dihydro-4H-naphthalen-1-yl]ethane-1,1-diol (PubChem CID 91051487) has the molecular formula C19H30O3S2 and a molecular weight of 370.58 g/mol. Its IUPAC name is 2-[(1R,4aS,5S)-5-(1,3-dithian-2-yl)-5-hydroxy-1,4a,6-trimethyl-8,8a-dihydro-4H-naphthalen-1-yl]ethane-1,1-diol.
| Compound Name | 2-[(1R,4aS,5S)-5-(1,3-dithian-2-yl)-5-hydroxy-1,4a,6-trimethyl-8,8a-dihydro-4H-naphthalen-1-yl]ethane-1,1-diol |
|---|---|
| PubChem CID | 91051487 |
| Molecular Formula | C19H30O3S2 |
| Molecular Weight | 370.58 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | 2-[(1R,4aS,5S)-5-(1,3-dithian-2-yl)-5-hydroxy-1,4a,6-trimethyl-8,8a-dihydro-4H-naphthalen-1-yl]ethane-1,1-diol |
| SMILES | CC1=CCC2[C@](C)(CC(O)O)C=CC[C@]2(C)[C@]1(O)C1SCCCS1 |
| InChI | InChI=1S/C19H30O3S2/c1-13-6-7-14-17(2,12-15(20)21)8-4-9-18(14,3)19(13,22)16-23-10-5-11-24-16/h4,6,8,14-16,20-22H,5,7,9-12H2,1-3H3/t14?,17-,18-,19+/m0/s1 |
| InChIKey | TZKBQNISFGBYTN-BIAVLDQUSA-N |
| XLogP | 3.55 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.58 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|