C15H22 — CID 163106075
(1S,2R,4S,7S,8R)-3,3,7,11-tetramethyltetracyclo[5.4.0.01,8.02,4]undec-10-ene (PubChem CID 163106075) has the molecular formula C15H22 and a molecular weight of 202.34 g/mol. Its IUPAC name is (1S,2R,4S,7S,8R)-3,3,7,11-tetramethyltetracyclo[5.4.0.01,8.02,4]undec-10-ene.
| Compound Name | (1S,2R,4S,7S,8R)-3,3,7,11-tetramethyltetracyclo[5.4.0.01,8.02,4]undec-10-ene |
|---|---|
| PubChem CID | 163106075 |
| Molecular Formula | C15H22 |
| Molecular Weight | 202.34 g/mol |
| Exact Mass | 202.17 |
| IUPAC Name | (1S,2R,4S,7S,8R)-3,3,7,11-tetramethyltetracyclo[5.4.0.01,8.02,4]undec-10-ene |
| SMILES | CC1=CC[C@H]2[C@]13[C@@H]1[C@H](CC[C@@]23C)C1(C)C |
| InChI | InChI=1S/C15H22/c1-9-5-6-11-14(4)8-7-10-12(13(10,2)3)15(9,11)14/h5,10-12H,6-8H2,1-4H3/t10-,11+,12+,14-,15-/m0/s1 |
| InChIKey | SYNYVXGDEQOMCB-HPYVJYLESA-N |
| XLogP | 4.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.34 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|