C12H16 — CID 101409828
(1S,5R,6R)-2,6-dimethyltricyclo[4.4.0.01,5]deca-2,9-diene (PubChem CID 101409828) has the molecular formula C12H16 and a molecular weight of 160.26 g/mol. Its IUPAC name is (1S,5R,6R)-2,6-dimethyltricyclo[4.4.0.01,5]deca-2,9-diene.
| Compound Name | (1S,5R,6R)-2,6-dimethyltricyclo[4.4.0.01,5]deca-2,9-diene |
|---|---|
| PubChem CID | 101409828 |
| Molecular Formula | C12H16 |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.13 |
| IUPAC Name | (1S,5R,6R)-2,6-dimethyltricyclo[4.4.0.01,5]deca-2,9-diene |
| SMILES | CC1=CC[C@@H]2[C@@]3(C)CCC=C[C@@]123 |
| InChI | InChI=1S/C12H16/c1-9-5-6-10-11(2)7-3-4-8-12(9,10)11/h4-5,8,10H,3,6-7H2,1-2H3/t10-,11-,12-/m1/s1 |
| InChIKey | GOAGZWVCKOCSLC-IJLUTSLNSA-N |
| XLogP | 3.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|