C19H26O3S2 — CID 10926659
(3aR,5aS,6R,9aR,9bS)-3a-(1,3-dithian-2-yl)-6-hydroxy-8,9a-dimethyl-2,3,5,5a,6,9b-hexahydro-1H-cyclopenta[a]naphthalene-4,9-dione (PubChem CID 10926659) has the molecular formula C19H26O3S2 and a molecular weight of 366.55 g/mol. Its IUPAC name is (3aR,5aS,6R,9aR,9bS)-3a-(1,3-dithian-2-yl)-6-hydroxy-8,9a-dimethyl-2,3,5,5a,6,9b-hexahydro-1H-cyclopenta[a]naphthalene-4,9-dione.
| Compound Name | (3aR,5aS,6R,9aR,9bS)-3a-(1,3-dithian-2-yl)-6-hydroxy-8,9a-dimethyl-2,3,5,5a,6,9b-hexahydro-1H-cyclopenta[a]naphthalene-4,9-dione |
|---|---|
| PubChem CID | 10926659 |
| Molecular Formula | C19H26O3S2 |
| Molecular Weight | 366.55 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | (3aR,5aS,6R,9aR,9bS)-3a-(1,3-dithian-2-yl)-6-hydroxy-8,9a-dimethyl-2,3,5,5a,6,9b-hexahydro-1H-cyclopenta[a]naphthalene-4,9-dione |
| SMILES | CC1=C[C@@H](O)[C@H]2CC(=O)[C@@]3(C4SCCCS4)CCC[C@H]3[C@@]2(C)C1=O |
| InChI | InChI=1S/C19H26O3S2/c1-11-9-13(20)12-10-15(21)19(17-23-7-4-8-24-17)6-3-5-14(19)18(12,2)16(11)22/h9,12-14,17,20H,3-8,10H2,1-2H3/t12-,13-,14+,18+,19-/m1/s1 |
| InChIKey | SMGHOTRDMNPFTN-GMYLRJOYSA-N |
| XLogP | 3.45 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.55 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |