C13H22S2 — CID 10633955
2-[(1S,3R)-1,3-dimethyl-2-methylidenecyclohexyl]-1,3-dithiane (PubChem CID 10633955) has the molecular formula C13H22S2 and a molecular weight of 242.45 g/mol. Its IUPAC name is 2-[(1S,3R)-1,3-dimethyl-2-methylidenecyclohexyl]-1,3-dithiane.
| Compound Name | 2-[(1S,3R)-1,3-dimethyl-2-methylidenecyclohexyl]-1,3-dithiane |
|---|---|
| PubChem CID | 10633955 |
| Molecular Formula | C13H22S2 |
| Molecular Weight | 242.45 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 2-[(1S,3R)-1,3-dimethyl-2-methylidenecyclohexyl]-1,3-dithiane |
| SMILES | C=C1[C@H](C)CCC[C@]1(C)C1SCCCS1 |
| InChI | InChI=1S/C13H22S2/c1-10-6-4-7-13(3,11(10)2)12-14-8-5-9-15-12/h10,12H,2,4-9H2,1,3H3/t10-,13+/m1/s1 |
| InChIKey | DXKWIOCFSYVGNM-MFKMUULPSA-N |
| XLogP | 4.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.45 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|